C36H30NP — CID 98000569
(1R,2S)-1,2-diphenyl-2-(13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)ethanamine (PubChem CID 98000569) has the molecular formula C36H30NP and a molecular weight of 507.62 g/mol. Its IUPAC name is (1R,2S)-1,2-diphenyl-2-(13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)ethanamine.
| Compound Name | (1R,2S)-1,2-diphenyl-2-(13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)ethanamine |
|---|---|
| PubChem CID | 98000569 |
| Molecular Formula | C36H30NP |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | (1R,2S)-1,2-diphenyl-2-(13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)ethanamine |
| SMILES | N[C@H](c1ccccc1)[C@H](c1ccccc1)P1Cc2ccc3ccccc3c2-c2c(ccc3ccccc23)C1 |
| InChI | InChI=1S/C36H30NP/c37-35(27-13-3-1-4-14-27)36(28-15-5-2-6-16-28)38-23-29-21-19-25-11-7-9-17-31(25)33(29)34-30(24-38)22-20-26-12-8-10-18-32(26)34/h1-22,35-36H,23-24,37H2/t35-,36+/m1/s1 |
| InChIKey | YHBAPPMVVCHAQC-XDSPJLLDSA-N |
| XLogP | 9.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|