C22H17N5O3 — CID 980025
ethyl 6-cyano-1-(3-methylphenyl)-5-oxo-7-phenyl-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxylate (PubChem CID 980025) has the molecular formula C22H17N5O3 and a molecular weight of 399.41 g/mol. Its IUPAC name is ethyl 6-cyano-1-(3-methylphenyl)-5-oxo-7-phenyl-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 6-cyano-1-(3-methylphenyl)-5-oxo-7-phenyl-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 980025 |
| Molecular Formula | C22H17N5O3 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | ethyl 6-cyano-1-(3-methylphenyl)-5-oxo-7-phenyl-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2cccc(C)c2)c2nc(-c3ccccc3)c(C#N)c(=O)n12 |
| InChI | InChI=1S/C22H17N5O3/c1-3-30-21(29)19-25-27(16-11-7-8-14(2)12-16)22-24-18(15-9-5-4-6-10-15)17(13-23)20(28)26(19)22/h4-12H,3H2,1-2H3 |
| InChIKey | CJSSZZHQFWDNMM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 102.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|