C25H15N5O2 — CID 11661659
3-benzoyl-5-oxo-1,7-diphenyl-[1,2,4]triazolo[4,3-a]pyrimidine-6-carbonitrile (PubChem CID 11661659) has the molecular formula C25H15N5O2 and a molecular weight of 417.43 g/mol. Its IUPAC name is 3-benzoyl-5-oxo-1,7-diphenyl-[1,2,4]triazolo[4,3-a]pyrimidine-6-carbonitrile.
| Compound Name | 3-benzoyl-5-oxo-1,7-diphenyl-[1,2,4]triazolo[4,3-a]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 11661659 |
| Molecular Formula | C25H15N5O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 3-benzoyl-5-oxo-1,7-diphenyl-[1,2,4]triazolo[4,3-a]pyrimidine-6-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc2n(-c3ccccc3)nc(C(=O)c3ccccc3)n2c1=O |
| InChI | InChI=1S/C25H15N5O2/c26-16-20-21(17-10-4-1-5-11-17)27-25-29(24(20)32)23(22(31)18-12-6-2-7-13-18)28-30(25)19-14-8-3-9-15-19/h1-15H |
| InChIKey | UEJCDSJJFRAIHV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 93.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|