C38H28N6O2S2 — CID 11467992
1-[2-[2-(5-cyano-6-oxo-2,4-diphenylpyrimidin-1-yl)ethyldisulfanyl]ethyl]-6-oxo-2,4-diphenylpyrimidine-5-carbonitrile (PubChem CID 11467992) has the molecular formula C38H28N6O2S2 and a molecular weight of 664.82 g/mol. Its IUPAC name is 1-[2-[2-(5-cyano-6-oxo-2,4-diphenylpyrimidin-1-yl)ethyldisulfanyl]ethyl]-6-oxo-2,4-diphenylpyrimidine-5-carbonitrile.
| Compound Name | 1-[2-[2-(5-cyano-6-oxo-2,4-diphenylpyrimidin-1-yl)ethyldisulfanyl]ethyl]-6-oxo-2,4-diphenylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 11467992 |
| Molecular Formula | C38H28N6O2S2 |
| Molecular Weight | 664.82 g/mol |
| Exact Mass | 664.17 |
| IUPAC Name | 1-[2-[2-(5-cyano-6-oxo-2,4-diphenylpyrimidin-1-yl)ethyldisulfanyl]ethyl]-6-oxo-2,4-diphenylpyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc(-c2ccccc2)n(CCSSCCn2c(-c3ccccc3)nc(-c3ccccc3)c(C#N)c2=O)c1=O |
| InChI | InChI=1S/C38H28N6O2S2/c39-25-31-33(27-13-5-1-6-14-27)41-35(29-17-9-3-10-18-29)43(37(31)45)21-23-47-48-24-22-44-36(30-19-11-4-12-20-30)42-34(32(26-40)38(44)46)28-15-7-2-8-16-28/h1-20H,21-24H2 |
| InChIKey | VSAHYWPNMFGVQC-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 117.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.82 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|