C29H17N5O4 — CID 102366087
5-benzoyl-12-methyl-7-phenyl-15-oxa-4,6,7,9,11-pentazapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-1,5,8,10,12,16,18,20-octaene-3,14-dione (PubChem CID 102366087) has the molecular formula C29H17N5O4 and a molecular weight of 499.49 g/mol. Its IUPAC name is 5-benzoyl-12-methyl-7-phenyl-15-oxa-4,6,7,9,11-pentazapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-1,5,8,10,12,16,18,20-octaene-3,14-dione.
| Compound Name | 5-benzoyl-12-methyl-7-phenyl-15-oxa-4,6,7,9,11-pentazapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-1,5,8,10,12,16,18,20-octaene-3,14-dione |
|---|---|
| PubChem CID | 102366087 |
| Molecular Formula | C29H17N5O4 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 5-benzoyl-12-methyl-7-phenyl-15-oxa-4,6,7,9,11-pentazapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-1,5,8,10,12,16,18,20-octaene-3,14-dione |
| SMILES | Cc1nc2nc3n(-c4ccccc4)nc(C(=O)c4ccccc4)n3c(=O)c2c2c1c(=O)oc1ccccc12 |
| InChI | InChI=1S/C29H17N5O4/c1-16-21-22(19-14-8-9-15-20(19)38-28(21)37)23-25(30-16)31-29-33(27(23)36)26(24(35)17-10-4-2-5-11-17)32-34(29)18-12-6-3-7-13-18/h2-15H,1H3 |
| InChIKey | FMSACUGDKRQNQS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 112.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|