C29H18N6O4 — CID 102366085
12-methyl-3,14-dioxo-N,7-diphenyl-15-oxa-4,6,7,9,11-pentazapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-1,5,8,10,12,16,18,20-octaene-5-carboxamide (PubChem CID 102366085) has the molecular formula C29H18N6O4 and a molecular weight of 514.50 g/mol. Its IUPAC name is 12-methyl-3,14-dioxo-N,7-diphenyl-15-oxa-4,6,7,9,11-pentazapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-1,5,8,10,12,16,18,20-octaene-5-carboxamide.
| Compound Name | 12-methyl-3,14-dioxo-N,7-diphenyl-15-oxa-4,6,7,9,11-pentazapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-1,5,8,10,12,16,18,20-octaene-5-carboxamide |
|---|---|
| PubChem CID | 102366085 |
| Molecular Formula | C29H18N6O4 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 12-methyl-3,14-dioxo-N,7-diphenyl-15-oxa-4,6,7,9,11-pentazapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-1,5,8,10,12,16,18,20-octaene-5-carboxamide |
| SMILES | Cc1nc2nc3n(-c4ccccc4)nc(C(=O)Nc4ccccc4)n3c(=O)c2c2c1c(=O)oc1ccccc12 |
| InChI | InChI=1S/C29H18N6O4/c1-16-21-22(19-14-8-9-15-20(19)39-28(21)38)23-24(30-16)32-29-34(27(23)37)25(26(36)31-17-10-4-2-5-11-17)33-35(29)18-12-6-3-7-13-18/h2-15H,1H3,(H,31,36) |
| InChIKey | LWNQWTXYQDTROH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|