C15H9N3O3S — CID 134838440
9-methyl-5-sulfanylidene-12-oxa-4,6,8-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1,7,9,13,15,17-hexaene-3,11-dione (PubChem CID 134838440) has the molecular formula C15H9N3O3S and a molecular weight of 311.32 g/mol. Its IUPAC name is 9-methyl-5-sulfanylidene-12-oxa-4,6,8-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1,7,9,13,15,17-hexaene-3,11-dione.
| Compound Name | 9-methyl-5-sulfanylidene-12-oxa-4,6,8-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1,7,9,13,15,17-hexaene-3,11-dione |
|---|---|
| PubChem CID | 134838440 |
| Molecular Formula | C15H9N3O3S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 9-methyl-5-sulfanylidene-12-oxa-4,6,8-triazatetracyclo[8.8.0.02,7.013,18]octadeca-1,7,9,13,15,17-hexaene-3,11-dione |
| SMILES | Cc1nc2[nH]c(=S)[nH]c(=O)c2c2c1c(=O)oc1ccccc12 |
| InChI | InChI=1S/C15H9N3O3S/c1-6-9-10(7-4-2-3-5-8(7)21-14(9)20)11-12(16-6)17-15(22)18-13(11)19/h2-5H,1H3,(H2,16,17,18,19,22) |
| InChIKey | PJYZLYIAALZDAW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|