About (2R,3R)-3-fluorooxolan-2-ol
(2R,3R)-3-fluorooxolan-2-ol (PubChem CID 98040547) has the molecular formula C4H7FO2
and a molecular weight of 106.10 g/mol. Its IUPAC name is (2R,3R)-3-fluorooxolan-2-ol.
Molecular Properties
| Compound Name | (2R,3R)-3-fluorooxolan-2-ol |
| PubChem CID | 98040547 |
| Molecular Formula | C4H7FO2 |
| Molecular Weight | 106.10 g/mol |
| Exact Mass | 106.04 |
| IUPAC Name | (2R,3R)-3-fluorooxolan-2-ol |
| SMILES | O[C@@H]1OCC[C@H]1F |
| InChI | InChI=1S/C4H7FO2/c5-3-1-2-7-4(3)6/h3-4,6H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | OWECLWPCZDIVDL-QWWZWVQMSA-N |
| XLogP | 0.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.10 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,3R)-3-fluorooxolan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-fluorooxolan-2-ol?
The IUPAC name of (2R,3R)-3-fluorooxolan-2-ol (CID 98040547) is (2R,3R)-3-fluorooxolan-2-ol.
What is the SMILES notation for (2R,3R)-3-fluorooxolan-2-ol?
The canonical SMILES for (2R,3R)-3-fluorooxolan-2-ol is O[C@@H]1OCC[C@H]1F.
What is the InChIKey of (2R,3R)-3-fluorooxolan-2-ol?
The InChIKey is OWECLWPCZDIVDL-QWWZWVQMSA-N. The full InChI is InChI=1S/C4H7FO2/c5-3-1-2-7-4(3)6/h3-4,6H,1-2H2/t3-,4-/m1/s1.
What are the key properties of (2R,3R)-3-fluorooxolan-2-ol?
(2R,3R)-3-fluorooxolan-2-ol has a molecular weight of 106.10 g/mol, XLogP of 0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-fluorooxolan-2-ol is sourced from PubChem (CID 98040547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).