C23H20N4O3 — CID 980411
1-(2,5-diphenyl-1,3-oxazol-4-yl)-4-morpholin-4-ylpyrimidin-2-one (PubChem CID 980411) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is 1-(2,5-diphenyl-1,3-oxazol-4-yl)-4-morpholin-4-ylpyrimidin-2-one.
| Compound Name | 1-(2,5-diphenyl-1,3-oxazol-4-yl)-4-morpholin-4-ylpyrimidin-2-one |
|---|---|
| PubChem CID | 980411 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-(2,5-diphenyl-1,3-oxazol-4-yl)-4-morpholin-4-ylpyrimidin-2-one |
| SMILES | O=c1nc(N2CCOCC2)ccn1-c1nc(-c2ccccc2)oc1-c1ccccc1 |
| InChI | InChI=1S/C23H20N4O3/c28-23-24-19(26-13-15-29-16-14-26)11-12-27(23)21-20(17-7-3-1-4-8-17)30-22(25-21)18-9-5-2-6-10-18/h1-12H,13-16H2 |
| InChIKey | ZZMFSARZRHZNDQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |