C26H35NO7 — CID 98045954
[(2R,4aS,6R,7S,8R,8aS)-7-acetamido-2-phenyl-6-prop-2-ynoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] octanoate (PubChem CID 98045954) has the molecular formula C26H35NO7 and a molecular weight of 473.57 g/mol. Its IUPAC name is [(2R,4aS,6R,7S,8R,8aS)-7-acetamido-2-phenyl-6-prop-2-ynoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] octanoate.
| Compound Name | [(2R,4aS,6R,7S,8R,8aS)-7-acetamido-2-phenyl-6-prop-2-ynoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] octanoate |
|---|---|
| PubChem CID | 98045954 |
| Molecular Formula | C26H35NO7 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | [(2R,4aS,6R,7S,8R,8aS)-7-acetamido-2-phenyl-6-prop-2-ynoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] octanoate |
| SMILES | C#CCO[C@@H]1O[C@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OC(=O)CCCCCCC)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C26H35NO7/c1-4-6-7-8-12-15-21(29)33-24-22(27-18(3)28)26(30-16-5-2)32-20-17-31-25(34-23(20)24)19-13-10-9-11-14-19/h2,9-11,13-14,20,22-26H,4,6-8,12,15-17H2,1,3H3,(H,27,28)/t20-,22-,23+,24+,25+,26+/m0/s1 |
| InChIKey | DEACSQNSYUFPTB-IZSJEIGXSA-N |
| XLogP | 3.25 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|