C7H11NO2 — CID 98053721
(1S,5S)-3-oxa-9-azabicyclo[3.3.1]nonan-7-one (PubChem CID 98053721) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (1S,5S)-3-oxa-9-azabicyclo[3.3.1]nonan-7-one.
| Compound Name | (1S,5S)-3-oxa-9-azabicyclo[3.3.1]nonan-7-one |
|---|---|
| PubChem CID | 98053721 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (1S,5S)-3-oxa-9-azabicyclo[3.3.1]nonan-7-one |
| SMILES | O=C1C[C@H]2COC[C@H](C1)N2 |
| InChI | InChI=1S/C7H11NO2/c9-7-1-5-3-10-4-6(2-7)8-5/h5-6,8H,1-4H2/t5-,6-/m0/s1 |
| InChIKey | NZOXKWYNXYBVGD-WDSKDSINSA-N |
| XLogP | -0.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |