C20H22N4O3 — CID 98058488
(1S,14S)-17-[2-(2-oxopyrrolidin-1-yl)acetyl]-3,11,17-triazatetracyclo[12.2.1.03,12.05,10]heptadeca-5,7,9,11-tetraen-4-one (PubChem CID 98058488) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is (1S,14S)-17-[2-(2-oxopyrrolidin-1-yl)acetyl]-3,11,17-triazatetracyclo[12.2.1.03,12.05,10]heptadeca-5,7,9,11-tetraen-4-one.
| Compound Name | (1S,14S)-17-[2-(2-oxopyrrolidin-1-yl)acetyl]-3,11,17-triazatetracyclo[12.2.1.03,12.05,10]heptadeca-5,7,9,11-tetraen-4-one |
|---|---|
| PubChem CID | 98058488 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (1S,14S)-17-[2-(2-oxopyrrolidin-1-yl)acetyl]-3,11,17-triazatetracyclo[12.2.1.03,12.05,10]heptadeca-5,7,9,11-tetraen-4-one |
| SMILES | O=C1CCCN1CC(=O)N1[C@H]2CC[C@H]1Cn1c(nc3ccccc3c1=O)C2 |
| InChI | InChI=1S/C20H22N4O3/c25-18-6-3-9-22(18)12-19(26)24-13-7-8-14(24)11-23-17(10-13)21-16-5-2-1-4-15(16)20(23)27/h1-2,4-5,13-14H,3,6-12H2/t13-,14-/m0/s1 |
| InChIKey | PGHCWOJPUTXJOK-KBPBESRZSA-N |
| XLogP | 0.93 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |