C19H17N3O3 — CID 98058433
(1S,14S)-17-(furan-2-carbonyl)-3,11,17-triazatetracyclo[12.2.1.03,12.05,10]heptadeca-5,7,9,11-tetraen-4-one (PubChem CID 98058433) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is (1S,14S)-17-(furan-2-carbonyl)-3,11,17-triazatetracyclo[12.2.1.03,12.05,10]heptadeca-5,7,9,11-tetraen-4-one.
| Compound Name | (1S,14S)-17-(furan-2-carbonyl)-3,11,17-triazatetracyclo[12.2.1.03,12.05,10]heptadeca-5,7,9,11-tetraen-4-one |
|---|---|
| PubChem CID | 98058433 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (1S,14S)-17-(furan-2-carbonyl)-3,11,17-triazatetracyclo[12.2.1.03,12.05,10]heptadeca-5,7,9,11-tetraen-4-one |
| SMILES | O=C(c1ccco1)N1[C@H]2CC[C@H]1Cn1c(nc3ccccc3c1=O)C2 |
| InChI | InChI=1S/C19H17N3O3/c23-18-14-4-1-2-5-15(14)20-17-10-12-7-8-13(11-21(17)18)22(12)19(24)16-6-3-9-25-16/h1-6,9,12-13H,7-8,10-11H2/t12-,13-/m0/s1 |
| InChIKey | CCEXIHWKIKYSBB-STQMWFEESA-N |
| XLogP | 2.22 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |