C20H18N4O2 — CID 46960603
17-(pyridine-4-carbonyl)-3,11,17-triazatetracyclo[12.2.1.03,12.05,10]heptadeca-5,7,9,11-tetraen-4-one (PubChem CID 46960603) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 17-(pyridine-4-carbonyl)-3,11,17-triazatetracyclo[12.2.1.03,12.05,10]heptadeca-5,7,9,11-tetraen-4-one.
| Compound Name | 17-(pyridine-4-carbonyl)-3,11,17-triazatetracyclo[12.2.1.03,12.05,10]heptadeca-5,7,9,11-tetraen-4-one |
|---|---|
| PubChem CID | 46960603 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 17-(pyridine-4-carbonyl)-3,11,17-triazatetracyclo[12.2.1.03,12.05,10]heptadeca-5,7,9,11-tetraen-4-one |
| SMILES | O=C(c1ccncc1)N1C2CCC1Cn1c(nc3ccccc3c1=O)C2 |
| InChI | InChI=1S/C20H18N4O2/c25-19(13-7-9-21-10-8-13)24-14-5-6-15(24)12-23-18(11-14)22-17-4-2-1-3-16(17)20(23)26/h1-4,7-10,14-15H,5-6,11-12H2 |
| InChIKey | CRQLQFMOVAJFPC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |