C26H28N4O3 — CID 98066611
(1S,2R,6S,7S)-4-(2-oxo-2-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylethyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 98066611) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is (1S,2R,6S,7S)-4-(2-oxo-2-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylethyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1S,2R,6S,7S)-4-(2-oxo-2-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylethyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 98066611 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | (1S,2R,6S,7S)-4-(2-oxo-2-spiro[5H-pyrrolo[1,2-a]quinoxaline-4,4'-piperidine]-1'-ylethyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C(CN1C(=O)[C@@H]2[C@H]3CC[C@@H](C3)[C@@H]2C1=O)N1CCC2(CC1)Nc1ccccc1-n1cccc12 |
| InChI | InChI=1S/C26H28N4O3/c31-21(15-30-24(32)22-16-7-8-17(14-16)23(22)25(30)33)28-12-9-26(10-13-28)20-6-3-11-29(20)19-5-2-1-4-18(19)27-26/h1-6,11,16-17,22-23,27H,7-10,12-15H2/t16-,17-,22-,23+/m0/s1 |
| InChIKey | CNHLSXAQEJPQCA-BSWISCRUSA-N |
| XLogP | 2.75 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|