C29H29BrN4O4S — CID 98076446
2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[(Z)-[1-(2-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide (PubChem CID 98076446) has the molecular formula C29H29BrN4O4S and a molecular weight of 609.55 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[(Z)-[1-(2-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[(Z)-[1-(2-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98076446 |
| Molecular Formula | C29H29BrN4O4S |
| Molecular Weight | 609.55 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[(Z)-[1-(2-bromophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)N/N=C\c1cc(C)n(-c2ccccc2Br)c1C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H29BrN4O4S/c1-4-38-28-17-11-10-16-27(28)33(39(36,37)24-12-6-5-7-13-24)20-29(35)32-31-19-23-18-21(2)34(22(23)3)26-15-9-8-14-25(26)30/h5-19H,4,20H2,1-3H3,(H,32,35)/b31-19- |
| InChIKey | PRGVVNKMAKJXDY-DXJNIWACSA-N |
| XLogP | 5.60 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|