C35H26BrNO3 — CID 98082254
(3Z)-3-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-5-(4-ethoxyphenyl)furan-2-one (PubChem CID 98082254) has the molecular formula C35H26BrNO3 and a molecular weight of 588.50 g/mol. Its IUPAC name is (3Z)-3-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-5-(4-ethoxyphenyl)furan-2-one.
| Compound Name | (3Z)-3-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-5-(4-ethoxyphenyl)furan-2-one |
|---|---|
| PubChem CID | 98082254 |
| Molecular Formula | C35H26BrNO3 |
| Molecular Weight | 588.50 g/mol |
| Exact Mass | 587.11 |
| IUPAC Name | (3Z)-3-[[1-(4-bromophenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-5-(4-ethoxyphenyl)furan-2-one |
| SMILES | CCOc1ccc(C2=C/C(=C/c3cc(-c4ccccc4)n(-c4ccc(Br)cc4)c3-c3ccccc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C35H26BrNO3/c1-2-39-31-19-13-25(14-20-31)33-23-28(35(38)40-33)21-27-22-32(24-9-5-3-6-10-24)37(30-17-15-29(36)16-18-30)34(27)26-11-7-4-8-12-26/h3-23H,2H2,1H3/b28-21- |
| InChIKey | MHUJWULHMJJZIU-HFTWOUSFSA-N |
| XLogP | 8.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.50 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|