C28H24BrNO2 — CID 4073969
2-(4-bromophenyl)-1-(4-ethoxyphenyl)-6-phenyl-6,7-dihydro-5H-indol-4-one (PubChem CID 4073969) has the molecular formula C28H24BrNO2 and a molecular weight of 486.41 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(4-ethoxyphenyl)-6-phenyl-6,7-dihydro-5H-indol-4-one.
| Compound Name | 2-(4-bromophenyl)-1-(4-ethoxyphenyl)-6-phenyl-6,7-dihydro-5H-indol-4-one |
|---|---|
| PubChem CID | 4073969 |
| Molecular Formula | C28H24BrNO2 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 2-(4-bromophenyl)-1-(4-ethoxyphenyl)-6-phenyl-6,7-dihydro-5H-indol-4-one |
| SMILES | CCOc1ccc(-n2c(-c3ccc(Br)cc3)cc3c2CC(c2ccccc2)CC3=O)cc1 |
| InChI | InChI=1S/C28H24BrNO2/c1-2-32-24-14-12-23(13-15-24)30-26(20-8-10-22(29)11-9-20)18-25-27(30)16-21(17-28(25)31)19-6-4-3-5-7-19/h3-15,18,21H,2,16-17H2,1H3 |
| InChIKey | GANHNGTUQSAUAP-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|