C10H10Br2O2 — CID 98083534
(1R,3R,5S,7R)-1,5-dibromoadamantane-2,6-dione (PubChem CID 98083534) has the molecular formula C10H10Br2O2 and a molecular weight of 322.00 g/mol. Its IUPAC name is (1R,3R,5S,7R)-1,5-dibromoadamantane-2,6-dione.
| Compound Name | (1R,3R,5S,7R)-1,5-dibromoadamantane-2,6-dione |
|---|---|
| PubChem CID | 98083534 |
| Molecular Formula | C10H10Br2O2 |
| Molecular Weight | 322.00 g/mol |
| Exact Mass | 319.90 |
| IUPAC Name | (1R,3R,5S,7R)-1,5-dibromoadamantane-2,6-dione |
| SMILES | O=C1[C@@H]2C[C@@H]3C[C@@]1(Br)C[C@@](Br)(C2)C3=O |
| InChI | InChI=1S/C10H10Br2O2/c11-9-2-5-1-6(8(9)14)3-10(12,4-9)7(5)13/h5-6H,1-4H2/t5-,6-,9-,10+/m1/s1 |
| InChIKey | CUKJLWYGSXJZHD-QLSQZMLOSA-N |
| XLogP | 2.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.00 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|