C10H14N2O2 — CID 98349629
(1R,3S,5R,7R)-1,5-diaminoadamantane-2,6-dione (PubChem CID 98349629) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is (1R,3S,5R,7R)-1,5-diaminoadamantane-2,6-dione.
| Compound Name | (1R,3S,5R,7R)-1,5-diaminoadamantane-2,6-dione |
|---|---|
| PubChem CID | 98349629 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (1R,3S,5R,7R)-1,5-diaminoadamantane-2,6-dione |
| SMILES | N[C@]12C[C@@H]3C[C@H](C[C@@](N)(C1)C3=O)C2=O |
| InChI | InChI=1S/C10H14N2O2/c11-9-2-5-1-6(8(9)14)3-10(12,4-9)7(5)13/h5-6H,1-4,11-12H2/t5-,6+,9-,10-/m1/s1 |
| InChIKey | BVVSEEPMQJVZRX-MLTZYSBQSA-N |
| XLogP | -0.65 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |