C30H27NO10 — CID 98085498
(5R)-1-(1,3-benzodioxol-5-ylmethyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 98085498) has the molecular formula C30H27NO10 and a molecular weight of 561.54 g/mol. Its IUPAC name is (5R)-1-(1,3-benzodioxol-5-ylmethyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-1-(1,3-benzodioxol-5-ylmethyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98085498 |
| Molecular Formula | C30H27NO10 |
| Molecular Weight | 561.54 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | (5R)-1-(1,3-benzodioxol-5-ylmethyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc([C@@H]2C(=C(O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2Cc2ccc3c(c2)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C30H27NO10/c1-35-23-12-18(13-24(36-2)29(23)37-3)26-25(27(32)17-5-7-19-22(11-17)39-9-8-38-19)28(33)30(34)31(26)14-16-4-6-20-21(10-16)41-15-40-20/h4-7,10-13,26,32H,8-9,14-15H2,1-3H3/t26-/m1/s1 |
| InChIKey | LINRMCMSFBFQKD-AREMUKBSSA-N |
| XLogP | 3.83 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|