C8H13NO2 — CID 98089092
(4S)-3-tert-butyl-4-methyl-4H-1,2-oxazol-5-one (PubChem CID 98089092) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (4S)-3-tert-butyl-4-methyl-4H-1,2-oxazol-5-one.
| Compound Name | (4S)-3-tert-butyl-4-methyl-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 98089092 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (4S)-3-tert-butyl-4-methyl-4H-1,2-oxazol-5-one |
| SMILES | C[C@@H]1C(=O)ON=C1C(C)(C)C |
| InChI | InChI=1S/C8H13NO2/c1-5-6(8(2,3)4)9-11-7(5)10/h5H,1-4H3/t5-/m0/s1 |
| InChIKey | JGQGLZMTQUDUQX-YFKPBYRVSA-N |
| XLogP | 1.58 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|