C16H24N2O4 — CID 10267267
3-tert-butyl-4-(3-tert-butyl-4-methyl-5-oxo-1,2-oxazol-4-yl)-4-methyl-1,2-oxazol-5-one (PubChem CID 10267267) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-tert-butyl-4-(3-tert-butyl-4-methyl-5-oxo-1,2-oxazol-4-yl)-4-methyl-1,2-oxazol-5-one.
| Compound Name | 3-tert-butyl-4-(3-tert-butyl-4-methyl-5-oxo-1,2-oxazol-4-yl)-4-methyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 10267267 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-tert-butyl-4-(3-tert-butyl-4-methyl-5-oxo-1,2-oxazol-4-yl)-4-methyl-1,2-oxazol-5-one |
| SMILES | CC(C)(C)C1=NOC(=O)C1(C)C1(C)C(=O)ON=C1C(C)(C)C |
| InChI | InChI=1S/C16H24N2O4/c1-13(2,3)9-15(7,11(19)21-17-9)16(8)10(14(4,5)6)18-22-12(16)20/h1-8H3 |
| InChIKey | MMWIGVDFPDPEIH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|