C13H22O3 — CID 134260914
3,4-ditert-butyl-3-methyloxolane-2,5-dione (PubChem CID 134260914) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3,4-ditert-butyl-3-methyloxolane-2,5-dione.
| Compound Name | 3,4-ditert-butyl-3-methyloxolane-2,5-dione |
|---|---|
| PubChem CID | 134260914 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 3,4-ditert-butyl-3-methyloxolane-2,5-dione |
| SMILES | CC(C)(C)C1C(=O)OC(=O)C1(C)C(C)(C)C |
| InChI | InChI=1S/C13H22O3/c1-11(2,3)8-9(14)16-10(15)13(8,7)12(4,5)6/h8H,1-7H3 |
| InChIKey | VLQXMPRGFFXGNU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|