C6H8O3S — CID 87544579
3,3-dimethyl-1,4-oxathiane-2,6-dione (PubChem CID 87544579) has the molecular formula C6H8O3S and a molecular weight of 160.19 g/mol. Its IUPAC name is 3,3-dimethyl-1,4-oxathiane-2,6-dione.
| Compound Name | 3,3-dimethyl-1,4-oxathiane-2,6-dione |
|---|---|
| PubChem CID | 87544579 |
| Molecular Formula | C6H8O3S |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | 3,3-dimethyl-1,4-oxathiane-2,6-dione |
| SMILES | CC1(C)SCC(=O)OC1=O |
| InChI | InChI=1S/C6H8O3S/c1-6(2)5(8)9-4(7)3-10-6/h3H2,1-2H3 |
| InChIKey | RSWNBRATJQQBEC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|