C16H17ClO3 — CID 98095717
cis-(2S,4S)-4-chloro-5,5-dimethyl-2-(2-phenylacetyl)cyclohexane-1,3-dione (PubChem CID 98095717) has the molecular formula C16H17ClO3 and a molecular weight of 292.76 g/mol. Its IUPAC name is cis-(2S,4S)-4-chloro-5,5-dimethyl-2-(2-phenylacetyl)cyclohexane-1,3-dione.
| Compound Name | cis-(2S,4S)-4-chloro-5,5-dimethyl-2-(2-phenylacetyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 98095717 |
| Molecular Formula | C16H17ClO3 |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | cis-(2S,4S)-4-chloro-5,5-dimethyl-2-(2-phenylacetyl)cyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)[C@H](C(=O)Cc2ccccc2)C(=O)[C@H]1Cl |
| InChI | InChI=1S/C16H17ClO3/c1-16(2)9-12(19)13(14(20)15(16)17)11(18)8-10-6-4-3-5-7-10/h3-7,13,15H,8-9H2,1-2H3/t13-,15+/m0/s1 |
| InChIKey | IKZRJPUGMXAEHP-DZGCQCFKSA-N |
| XLogP | 2.59 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|