C15H14O6 — CID 91564122
methyl 2-[3,5-dioxo-4-(2-phenylacetyl)oxolan-2-yl]acetate (PubChem CID 91564122) has the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. Its IUPAC name is methyl 2-[3,5-dioxo-4-(2-phenylacetyl)oxolan-2-yl]acetate.
| Compound Name | methyl 2-[3,5-dioxo-4-(2-phenylacetyl)oxolan-2-yl]acetate |
|---|---|
| PubChem CID | 91564122 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | methyl 2-[3,5-dioxo-4-(2-phenylacetyl)oxolan-2-yl]acetate |
| SMILES | COC(=O)CC1OC(=O)C(C(=O)Cc2ccccc2)C1=O |
| InChI | InChI=1S/C15H14O6/c1-20-12(17)8-11-14(18)13(15(19)21-11)10(16)7-9-5-3-2-4-6-9/h2-6,11,13H,7-8H2,1H3 |
| InChIKey | TXPLISPSNRMPIU-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|