C16H18O4S — CID 11185843
5-(2-methylsulfanylpropyl)-3-(2-phenylacetyl)oxolane-2,4-dione (PubChem CID 11185843) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is 5-(2-methylsulfanylpropyl)-3-(2-phenylacetyl)oxolane-2,4-dione.
| Compound Name | 5-(2-methylsulfanylpropyl)-3-(2-phenylacetyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 11185843 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 5-(2-methylsulfanylpropyl)-3-(2-phenylacetyl)oxolane-2,4-dione |
| SMILES | CSC(C)CC1OC(=O)C(C(=O)Cc2ccccc2)C1=O |
| InChI | InChI=1S/C16H18O4S/c1-10(21-2)8-13-15(18)14(16(19)20-13)12(17)9-11-6-4-3-5-7-11/h3-7,10,13-14H,8-9H2,1-2H3 |
| InChIKey | AFJGTIKVFGKHNW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|