C18H22O4S — CID 69136101
3-hydroxy-2-(2-methylsulfanylpropyl)-4-(4-phenylbutanoyl)-2H-furan-5-one (PubChem CID 69136101) has the molecular formula C18H22O4S and a molecular weight of 334.44 g/mol. Its IUPAC name is 3-hydroxy-2-(2-methylsulfanylpropyl)-4-(4-phenylbutanoyl)-2H-furan-5-one.
| Compound Name | 3-hydroxy-2-(2-methylsulfanylpropyl)-4-(4-phenylbutanoyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 69136101 |
| Molecular Formula | C18H22O4S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 3-hydroxy-2-(2-methylsulfanylpropyl)-4-(4-phenylbutanoyl)-2H-furan-5-one |
| SMILES | CSC(C)CC1OC(=O)C(C(=O)CCCc2ccccc2)=C1O |
| InChI | InChI=1S/C18H22O4S/c1-12(23-2)11-15-17(20)16(18(21)22-15)14(19)10-6-9-13-7-4-3-5-8-13/h3-5,7-8,12,15,20H,6,9-11H2,1-2H3 |
| InChIKey | JRWRFPJYQRZDHI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|