C28H24O4 — CID 69135143
4-[2-(9H-fluoren-9-yl)acetyl]-3-hydroxy-2-(3-phenylpropyl)-2H-furan-5-one (PubChem CID 69135143) has the molecular formula C28H24O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 4-[2-(9H-fluoren-9-yl)acetyl]-3-hydroxy-2-(3-phenylpropyl)-2H-furan-5-one.
| Compound Name | 4-[2-(9H-fluoren-9-yl)acetyl]-3-hydroxy-2-(3-phenylpropyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 69135143 |
| Molecular Formula | C28H24O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 4-[2-(9H-fluoren-9-yl)acetyl]-3-hydroxy-2-(3-phenylpropyl)-2H-furan-5-one |
| SMILES | O=C(CC1c2ccccc2-c2ccccc21)C1=C(O)C(CCCc2ccccc2)OC1=O |
| InChI | InChI=1S/C28H24O4/c29-24(17-23-21-14-6-4-12-19(21)20-13-5-7-15-22(20)23)26-27(30)25(32-28(26)31)16-8-11-18-9-2-1-3-10-18/h1-7,9-10,12-15,23,25,30H,8,11,16-17H2 |
| InChIKey | QCEQNYVRDVZHFV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|