C20H19F3N2O — CID 98098081
N-[(Z)-[(1S,2S,4S,6R)-6-(trifluoromethyl)-2-bicyclo[2.2.1]heptanyl]methylideneamino]naphthalene-1-carboxamide (PubChem CID 98098081) has the molecular formula C20H19F3N2O and a molecular weight of 360.38 g/mol. Its IUPAC name is N-[(Z)-[(1S,2S,4S,6R)-6-(trifluoromethyl)-2-bicyclo[2.2.1]heptanyl]methylideneamino]naphthalene-1-carboxamide.
| Compound Name | N-[(Z)-[(1S,2S,4S,6R)-6-(trifluoromethyl)-2-bicyclo[2.2.1]heptanyl]methylideneamino]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 98098081 |
| Molecular Formula | C20H19F3N2O |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-[(Z)-[(1S,2S,4S,6R)-6-(trifluoromethyl)-2-bicyclo[2.2.1]heptanyl]methylideneamino]naphthalene-1-carboxamide |
| SMILES | O=C(N/N=C\[C@H]1C[C@@H]2C[C@@H]1[C@H](C(F)(F)F)C2)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H19F3N2O/c21-20(22,23)18-10-12-8-14(17(18)9-12)11-24-25-19(26)16-7-3-5-13-4-1-2-6-15(13)16/h1-7,11-12,14,17-18H,8-10H2,(H,25,26)/b24-11-/t12-,14-,17+,18-/m1/s1 |
| InChIKey | GOTBAYUOSRIHTK-FAJPQMABSA-N |
| XLogP | 4.78 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|