C13H12O6 — CID 98107543
(4S)-4-(3,4-dimethoxybenzoyl)oxolane-2,3-dione (PubChem CID 98107543) has the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. Its IUPAC name is (4S)-4-(3,4-dimethoxybenzoyl)oxolane-2,3-dione.
| Compound Name | (4S)-4-(3,4-dimethoxybenzoyl)oxolane-2,3-dione |
|---|---|
| PubChem CID | 98107543 |
| Molecular Formula | C13H12O6 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | (4S)-4-(3,4-dimethoxybenzoyl)oxolane-2,3-dione |
| SMILES | COc1ccc(C(=O)[C@@H]2COC(=O)C2=O)cc1OC |
| InChI | InChI=1S/C13H12O6/c1-17-9-4-3-7(5-10(9)18-2)11(14)8-6-19-13(16)12(8)15/h3-5,8H,6H2,1-2H3/t8-/m0/s1 |
| InChIKey | ANKNPLFVOPOROF-QMMMGPOBSA-N |
| XLogP | 0.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|