C14H13F3O2 — CID 98107848
trans-(2R,4R)-4-phenyl-2-(2,2,2-trifluoroacetyl)cyclohexan-1-one (PubChem CID 98107848) has the molecular formula C14H13F3O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is trans-(2R,4R)-4-phenyl-2-(2,2,2-trifluoroacetyl)cyclohexan-1-one.
| Compound Name | trans-(2R,4R)-4-phenyl-2-(2,2,2-trifluoroacetyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 98107848 |
| Molecular Formula | C14H13F3O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | trans-(2R,4R)-4-phenyl-2-(2,2,2-trifluoroacetyl)cyclohexan-1-one |
| SMILES | O=C1CC[C@@H](c2ccccc2)C[C@H]1C(=O)C(F)(F)F |
| InChI | InChI=1S/C14H13F3O2/c15-14(16,17)13(19)11-8-10(6-7-12(11)18)9-4-2-1-3-5-9/h1-5,10-11H,6-8H2/t10-,11-/m1/s1 |
| InChIKey | SUZJLDFEUUTROO-GHMZBOCLSA-N |
| XLogP | 3.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|