C15H12F6O — CID 155397135
2-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-4-phenylcyclohexan-1-one (PubChem CID 155397135) has the molecular formula C15H12F6O and a molecular weight of 322.25 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-4-phenylcyclohexan-1-one.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-4-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 155397135 |
| Molecular Formula | C15H12F6O |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-4-phenylcyclohexan-1-one |
| SMILES | O=C1CCC(c2ccccc2)CC1=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H12F6O/c16-14(17,18)13(15(19,20)21)11-8-10(6-7-12(11)22)9-4-2-1-3-5-9/h1-5,10H,6-8H2 |
| InChIKey | ZBLISLABOYIBDA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|