C16H12F8O — CID 164806133
(2Z)-2-(1,2,2,3,3,4,4,4-octafluorobutylidene)-4-phenylcyclohexan-1-one (PubChem CID 164806133) has the molecular formula C16H12F8O and a molecular weight of 372.26 g/mol. Its IUPAC name is (2Z)-2-(1,2,2,3,3,4,4,4-octafluorobutylidene)-4-phenylcyclohexan-1-one.
| Compound Name | (2Z)-2-(1,2,2,3,3,4,4,4-octafluorobutylidene)-4-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 164806133 |
| Molecular Formula | C16H12F8O |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (2Z)-2-(1,2,2,3,3,4,4,4-octafluorobutylidene)-4-phenylcyclohexan-1-one |
| SMILES | O=C1CCC(c2ccccc2)C/C1=C(/F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H12F8O/c17-13(14(18,19)15(20,21)16(22,23)24)11-8-10(6-7-12(11)25)9-4-2-1-3-5-9/h1-5,10H,6-8H2/b13-11- |
| InChIKey | XBRIKIZDIFONAU-QBFSEMIESA-N |
| XLogP | 5.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|