C17H24N2O2 — CID 98108756
(1S,5S)-1,3,3-trimethyl-6-[(4-nitrophenyl)methyl]-6-azabicyclo[3.2.1]octane (PubChem CID 98108756) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (1S,5S)-1,3,3-trimethyl-6-[(4-nitrophenyl)methyl]-6-azabicyclo[3.2.1]octane.
| Compound Name | (1S,5S)-1,3,3-trimethyl-6-[(4-nitrophenyl)methyl]-6-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 98108756 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (1S,5S)-1,3,3-trimethyl-6-[(4-nitrophenyl)methyl]-6-azabicyclo[3.2.1]octane |
| SMILES | CC1(C)C[C@H]2C[C@@](C)(CN2Cc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C17H24N2O2/c1-16(2)8-15-9-17(3,11-16)12-18(15)10-13-4-6-14(7-5-13)19(20)21/h4-7,15H,8-12H2,1-3H3/t15-,17+/m0/s1 |
| InChIKey | VWWZPIRISOLYAP-DOTOQJQBSA-N |
| XLogP | 4.00 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|