C24H26N4O2 — CID 98088929
2-(4-nitrophenyl)-4-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]quinazoline (PubChem CID 98088929) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-4-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]quinazoline.
| Compound Name | 2-(4-nitrophenyl)-4-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]quinazoline |
|---|---|
| PubChem CID | 98088929 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-(4-nitrophenyl)-4-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]quinazoline |
| SMILES | CC1(C)C[C@@H]2C[C@](C)(CN2c2nc(-c3ccc([N+](=O)[O-])cc3)nc3ccccc23)C1 |
| InChI | InChI=1S/C24H26N4O2/c1-23(2)12-18-13-24(3,14-23)15-27(18)22-19-6-4-5-7-20(19)25-21(26-22)16-8-10-17(11-9-16)28(29)30/h4-11,18H,12-15H2,1-3H3/t18-,24+/m1/s1 |
| InChIKey | GOEOGIUQQGWDHE-KOSHJBKYSA-N |
| XLogP | 5.61 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|