C21H27N3O — CID 10472268
3-prop-2-enyl-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazolin-4-one (PubChem CID 10472268) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 3-prop-2-enyl-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazolin-4-one.
| Compound Name | 3-prop-2-enyl-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 10472268 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 3-prop-2-enyl-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazolin-4-one |
| SMILES | C=CCn1c(N2CC3(C)CC2CC(C)(C)C3)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H27N3O/c1-5-10-23-18(25)16-8-6-7-9-17(16)22-19(23)24-14-21(4)12-15(24)11-20(2,3)13-21/h5-9,15H,1,10-14H2,2-4H3 |
| InChIKey | LBOWBIVJHHCVAO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|