C10H22N2O — CID 98110141
(2R,4S,5S)-4-(2-aminoethyl)-1,2,5-trimethylpiperidin-4-ol (PubChem CID 98110141) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is (2R,4S,5S)-4-(2-aminoethyl)-1,2,5-trimethylpiperidin-4-ol.
| Compound Name | (2R,4S,5S)-4-(2-aminoethyl)-1,2,5-trimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 98110141 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | (2R,4S,5S)-4-(2-aminoethyl)-1,2,5-trimethylpiperidin-4-ol |
| SMILES | C[C@@H]1C[C@@](O)(CCN)[C@@H](C)CN1C |
| InChI | InChI=1S/C10H22N2O/c1-8-7-12(3)9(2)6-10(8,13)4-5-11/h8-9,13H,4-7,11H2,1-3H3/t8-,9+,10-/m0/s1 |
| InChIKey | DAWYGKVEFAQSQF-AEJSXWLSSA-N |
| XLogP | 0.43 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |