C27H33N3O6 — CID 98111120
ethyl 3-[(1R,2S,5S,6R,7R)-2-(tert-butylcarbamoyl)-6-(cyclopropylcarbamoyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-3-yl]benzoate (PubChem CID 98111120) has the molecular formula C27H33N3O6 and a molecular weight of 495.58 g/mol. Its IUPAC name is ethyl 3-[(1R,2S,5S,6R,7R)-2-(tert-butylcarbamoyl)-6-(cyclopropylcarbamoyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-3-yl]benzoate.
| Compound Name | ethyl 3-[(1R,2S,5S,6R,7R)-2-(tert-butylcarbamoyl)-6-(cyclopropylcarbamoyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-3-yl]benzoate |
|---|---|
| PubChem CID | 98111120 |
| Molecular Formula | C27H33N3O6 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | ethyl 3-[(1R,2S,5S,6R,7R)-2-(tert-butylcarbamoyl)-6-(cyclopropylcarbamoyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-3-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(N2C(=O)[C@H]3[C@@H](C(=O)NC4CC4)[C@@]4(C)C=C[C@]3(O4)[C@H]2C(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C27H33N3O6/c1-6-35-24(34)15-8-7-9-17(14-15)30-20(22(32)29-25(2,3)4)27-13-12-26(5,36-27)18(19(27)23(30)33)21(31)28-16-10-11-16/h7-9,12-14,16,18-20H,6,10-11H2,1-5H3,(H,28,31)(H,29,32)/t18-,19+,20+,26+,27+/m0/s1 |
| InChIKey | JITJXNRZRRHLIV-KCQDNIDCSA-N |
| XLogP | 2.10 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|