C26H32N2O5 — CID 98112007
[(2S)-1-(cyclopentylamino)-1-oxobutan-2-yl] (1S,5R,6R,7S)-3-(3,5-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 98112007) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is [(2S)-1-(cyclopentylamino)-1-oxobutan-2-yl] (1S,5R,6R,7S)-3-(3,5-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | [(2S)-1-(cyclopentylamino)-1-oxobutan-2-yl] (1S,5R,6R,7S)-3-(3,5-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 98112007 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | [(2S)-1-(cyclopentylamino)-1-oxobutan-2-yl] (1S,5R,6R,7S)-3-(3,5-dimethylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | CC[C@H](OC(=O)[C@H]1[C@@H]2C=C[C@]3(CN(c4cc(C)cc(C)c4)C(=O)[C@H]13)O2)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C26H32N2O5/c1-4-19(23(29)27-17-7-5-6-8-17)32-25(31)21-20-9-10-26(33-20)14-28(24(30)22(21)26)18-12-15(2)11-16(3)13-18/h9-13,17,19-22H,4-8,14H2,1-3H3,(H,27,29)/t19-,20-,21-,22-,26+/m0/s1 |
| InChIKey | YLPKDSMBYDEWEI-LEUUJVKFSA-N |
| XLogP | 2.97 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|