C11H7Cl2NO2 — CID 98116020
(2S)-5,6-dichloro-2-phenyl-1,2-dihydropyridine-3,4-dione (PubChem CID 98116020) has the molecular formula C11H7Cl2NO2 and a molecular weight of 256.09 g/mol. Its IUPAC name is (2S)-5,6-dichloro-2-phenyl-1,2-dihydropyridine-3,4-dione.
| Compound Name | (2S)-5,6-dichloro-2-phenyl-1,2-dihydropyridine-3,4-dione |
|---|---|
| PubChem CID | 98116020 |
| Molecular Formula | C11H7Cl2NO2 |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | (2S)-5,6-dichloro-2-phenyl-1,2-dihydropyridine-3,4-dione |
| SMILES | O=C1C(=O)[C@H](c2ccccc2)NC(Cl)=C1Cl |
| InChI | InChI=1S/C11H7Cl2NO2/c12-7-9(15)10(16)8(14-11(7)13)6-4-2-1-3-5-6/h1-5,8,14H/t8-/m0/s1 |
| InChIKey | DTZSAHBHHRFUPP-QMMMGPOBSA-N |
| XLogP | 2.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|