C23H15N5O4 — CID 98117948
N-[(Z)-[3-(1H-benzimidazol-2-yl)chromen-2-ylidene]amino]-4-nitrobenzamide (PubChem CID 98117948) has the molecular formula C23H15N5O4 and a molecular weight of 425.40 g/mol. Its IUPAC name is N-[(Z)-[3-(1H-benzimidazol-2-yl)chromen-2-ylidene]amino]-4-nitrobenzamide.
| Compound Name | N-[(Z)-[3-(1H-benzimidazol-2-yl)chromen-2-ylidene]amino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 98117948 |
| Molecular Formula | C23H15N5O4 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-[(Z)-[3-(1H-benzimidazol-2-yl)chromen-2-ylidene]amino]-4-nitrobenzamide |
| SMILES | O=C(N/N=c1\oc2ccccc2cc1-c1nc2ccccc2[nH]1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H15N5O4/c29-22(14-9-11-16(12-10-14)28(30)31)26-27-23-17(13-15-5-1-4-8-20(15)32-23)21-24-18-6-2-3-7-19(18)25-21/h1-13H,(H,24,25)(H,26,29)/b27-23- |
| InChIKey | PTMFJWPHWVZGFY-VYIQYICTSA-N |
| XLogP | 4.13 |
| TPSA | 126.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|