C12H12N4O5 — CID 98119142
(4R)-6-(hydroxymethyl)-4-[(E)-[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]-4H-pyran-3-ol (PubChem CID 98119142) has the molecular formula C12H12N4O5 and a molecular weight of 292.25 g/mol. Its IUPAC name is (4R)-6-(hydroxymethyl)-4-[(E)-[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]-4H-pyran-3-ol.
| Compound Name | (4R)-6-(hydroxymethyl)-4-[(E)-[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]-4H-pyran-3-ol |
|---|---|
| PubChem CID | 98119142 |
| Molecular Formula | C12H12N4O5 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | (4R)-6-(hydroxymethyl)-4-[(E)-[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]-4H-pyran-3-ol |
| SMILES | O=[N+]([O-])c1ccc(N/N=C/[C@H]2C=C(CO)OC=C2O)nc1 |
| InChI | InChI=1S/C12H12N4O5/c17-6-10-3-8(11(18)7-21-10)4-14-15-12-2-1-9(5-13-12)16(19)20/h1-5,7-8,17-18H,6H2,(H,13,15)/b14-4+/t8-/m1/s1 |
| InChIKey | HPLJDMPYMGWYQM-AWPGEDEESA-N |
| XLogP | 1.31 |
| TPSA | 130.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|