C17H14N6O5 — CID 21208970
5-nitro-N-[(E)-[4-[(5-nitro-2-pyridinyl)oxy]cyclohexa-2,4-dien-1-yl]methylideneamino]pyridin-2-amine (PubChem CID 21208970) has the molecular formula C17H14N6O5 and a molecular weight of 382.34 g/mol. Its IUPAC name is 5-nitro-N-[(E)-[4-[(5-nitro-2-pyridinyl)oxy]cyclohexa-2,4-dien-1-yl]methylideneamino]pyridin-2-amine.
| Compound Name | 5-nitro-N-[(E)-[4-[(5-nitro-2-pyridinyl)oxy]cyclohexa-2,4-dien-1-yl]methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 21208970 |
| Molecular Formula | C17H14N6O5 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 5-nitro-N-[(E)-[4-[(5-nitro-2-pyridinyl)oxy]cyclohexa-2,4-dien-1-yl]methylideneamino]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(N/N=C/C2C=CC(Oc3ccc([N+](=O)[O-])cn3)=CC2)nc1 |
| InChI | InChI=1S/C17H14N6O5/c24-22(25)13-3-7-16(18-10-13)21-20-9-12-1-5-15(6-2-12)28-17-8-4-14(11-19-17)23(26)27/h1,3-12H,2H2,(H,18,21)/b20-9+ |
| InChIKey | XSDAFAVAYZUAOJ-AWQFTUOYSA-N |
| XLogP | 3.23 |
| TPSA | 145.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|