C34H41O6PS2 — CID 98119546
(9R)-9-dicyclohexylphosphanyl-9-[3-(4-sulfophenyl)propyl]fluorene-2-sulfonic acid (PubChem CID 98119546) has the molecular formula C34H41O6PS2 and a molecular weight of 640.80 g/mol. Its IUPAC name is (9R)-9-dicyclohexylphosphanyl-9-[3-(4-sulfophenyl)propyl]fluorene-2-sulfonic acid.
| Compound Name | (9R)-9-dicyclohexylphosphanyl-9-[3-(4-sulfophenyl)propyl]fluorene-2-sulfonic acid |
|---|---|
| PubChem CID | 98119546 |
| Molecular Formula | C34H41O6PS2 |
| Molecular Weight | 640.80 g/mol |
| Exact Mass | 640.21 |
| IUPAC Name | (9R)-9-dicyclohexylphosphanyl-9-[3-(4-sulfophenyl)propyl]fluorene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(CCC[C@@]2(P(C3CCCCC3)C3CCCCC3)c3ccccc3-c3ccc(S(=O)(=O)O)cc32)cc1 |
| InChI | InChI=1S/C34H41O6PS2/c35-42(36,37)28-19-17-25(18-20-28)10-9-23-34(41(26-11-3-1-4-12-26)27-13-5-2-6-14-27)32-16-8-7-15-30(32)31-22-21-29(24-33(31)34)43(38,39)40/h7-8,15-22,24,26-27H,1-6,9-14,23H2,(H,35,36,37)(H,38,39,40)/t34-/m1/s1 |
| InChIKey | SQHWKPNZXIWOCK-UUWRZZSWSA-N |
| XLogP | 8.57 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.80 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|