C19H17Br2ClN4O4 — CID 98119919
N-[(Z)-2-(5-bromo-3-chloro-2-hydroxyphenyl)ethylideneamino]-2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetamide (PubChem CID 98119919) has the molecular formula C19H17Br2ClN4O4 and a molecular weight of 560.63 g/mol. Its IUPAC name is N-[(Z)-2-(5-bromo-3-chloro-2-hydroxyphenyl)ethylideneamino]-2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetamide.
| Compound Name | N-[(Z)-2-(5-bromo-3-chloro-2-hydroxyphenyl)ethylideneamino]-2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetamide |
|---|---|
| PubChem CID | 98119919 |
| Molecular Formula | C19H17Br2ClN4O4 |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 557.93 |
| IUPAC Name | N-[(Z)-2-(5-bromo-3-chloro-2-hydroxyphenyl)ethylideneamino]-2-[[5-bromo-3-cyano-4-(methoxymethyl)-6-methyl-2-pyridinyl]oxy]acetamide |
| SMILES | COCc1c(Br)c(C)nc(OCC(=O)N/N=C\Cc2cc(Br)cc(Cl)c2O)c1C#N |
| InChI | InChI=1S/C19H17Br2ClN4O4/c1-10-17(21)14(8-29-2)13(7-23)19(25-10)30-9-16(27)26-24-4-3-11-5-12(20)6-15(22)18(11)28/h4-6,28H,3,8-9H2,1-2H3,(H,26,27)/b24-4- |
| InChIKey | IAXLIAUZAGZLNO-QDPJQKAKSA-N |
| XLogP | 4.02 |
| TPSA | 116.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|