C9H6Cl2O2 — CID 98124000
(2S)-6,7-dichloro-2-methyl-1-benzofuran-3-one (PubChem CID 98124000) has the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. Its IUPAC name is (2S)-6,7-dichloro-2-methyl-1-benzofuran-3-one.
| Compound Name | (2S)-6,7-dichloro-2-methyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 98124000 |
| Molecular Formula | C9H6Cl2O2 |
| Molecular Weight | 217.05 g/mol |
| Exact Mass | 215.97 |
| IUPAC Name | (2S)-6,7-dichloro-2-methyl-1-benzofuran-3-one |
| SMILES | C[C@@H]1Oc2c(ccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C9H6Cl2O2/c1-4-8(12)5-2-3-6(10)7(11)9(5)13-4/h2-4H,1H3/t4-/m0/s1 |
| InChIKey | OLJHNKHHGCVVDO-BYPYZUCNSA-N |
| XLogP | 2.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.05 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |