C14H20N6S — CID 98127547
4-(dimethylamino)-2-methyl-5-(4-pyrrolidin-1-yl-2-pyridinyl)-1,2,4-triazole-3-thione (PubChem CID 98127547) has the molecular formula C14H20N6S and a molecular weight of 304.42 g/mol. Its IUPAC name is 4-(dimethylamino)-2-methyl-5-(4-pyrrolidin-1-yl-2-pyridinyl)-1,2,4-triazole-3-thione.
| Compound Name | 4-(dimethylamino)-2-methyl-5-(4-pyrrolidin-1-yl-2-pyridinyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 98127547 |
| Molecular Formula | C14H20N6S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 4-(dimethylamino)-2-methyl-5-(4-pyrrolidin-1-yl-2-pyridinyl)-1,2,4-triazole-3-thione |
| SMILES | CN(C)n1c(-c2cc(N3CCCC3)ccn2)nn(C)c1=S |
| InChI | InChI=1S/C14H20N6S/c1-17(2)20-13(16-18(3)14(20)21)12-10-11(6-7-15-12)19-8-4-5-9-19/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | ZTMQAEZOTXAFIF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|