C11H15N3O5 — CID 98129619
5-[(5R)-2-acetamido-4,6-dioxo-1H-pyrimidin-5-yl]pentanoic acid (PubChem CID 98129619) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is 5-[(5R)-2-acetamido-4,6-dioxo-1H-pyrimidin-5-yl]pentanoic acid.
| Compound Name | 5-[(5R)-2-acetamido-4,6-dioxo-1H-pyrimidin-5-yl]pentanoic acid |
|---|---|
| PubChem CID | 98129619 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 5-[(5R)-2-acetamido-4,6-dioxo-1H-pyrimidin-5-yl]pentanoic acid |
| SMILES | CC(=O)NC1=NC(=O)[C@H](CCCCC(=O)O)C(=O)N1 |
| InChI | InChI=1S/C11H15N3O5/c1-6(15)12-11-13-9(18)7(10(19)14-11)4-2-3-5-8(16)17/h7H,2-5H2,1H3,(H,16,17)(H2,12,13,14,15,18,19) |
| InChIKey | PKEQSGHRSSSKFF-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|